From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
5-Fluoro-EPT |
|
N-ethyl-N-[2-(5-fluoro-1H-indol-3-yl)ethyl]propan-1-amine
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
ChEMBL | |
---|
|
Formula | C15H21FN2 |
---|
Molar mass | 248.345 g·mol−1 |
---|
3D model (JSmol) | |
---|
CCCN(CC)CCC1=CNC2=C1C=C(C=C2)F
|
InChI=1S/C15H21FN2/c1-3-8-18(4-2)9-7-12-11-17-15-6-5-13(16)10-14(12)15/h5-6,10-11,17H,3-4,7-9H2,1-2H3 Key:QONMHCQBCANXJS-UHFFFAOYSA-N
|
5-Fluoro-EPT (5F-EPT, 5-fluoro-N-ethyl-N-propyltryptamine) is a psychedelic tryptamine derivative related to drugs such as EPT and 5-MeO-EPT. It acts as a potent full agonist at the 5-HT2A receptor with an EC50 of 5.54 nM and an efficacy of 104% (compared to serotonin). It produces a head-twitch response in animal studies, and is claimed to have antidepressant activity.[1]
|
---|
| No ring subs. | |
---|
4-Hydroxytryptamines | |
---|
5-Hydroxytryptamines | |
---|
5-Methoxytryptamines | |
---|
Other ring subs. |
- 2,N,N-TMT
- 4,N,N-TMT
- 5-Bromo-DMT
- 5-Chloro-DMT
- 5-Fluoro-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 6-Fluoro-DMT
- Bretisilocin (GM-2505; 5-fluoro-MET)
|
---|
α-Alkyltryptamines |
- 5-Methoxy-α-alkyltryptamines: 5-MeO-AET
- α,N,N-TMT (α-Me-DMT; Alpha-N)
- 5-MeO-AMT (α,O-DMS; Alpha-O)
- α,N,O-TMS (5-MeO-α,N-DMT)
- α,N,N,O-TeMS (5-MeO-α,N,N-TMT)
|
---|
Others | |
---|
|
- Ergolines/lysergamides (e.g., LSD)
- β-Carbolines and Harmala alkaloids (e.g., harmine, harmaline, 6-methoxyharmalan)
- Iboga alkaloids (e.g., 18-MAC, 18-MC, coronaridine, ibogaine, ibogamine, ME-18-MC, noribogaine, tabernanthine, voacangine)
- Ibogalogs (e.g., ibogainalog)
- O-Methylnordehydrobufotenine
- Partial ergolines (e.g., NDTDI, RU-28306, CT-5252)
- Piperidinylethylindoles (e.g., Pip-T)
- Pyrrolidinylethylindoles (e.g., Pyr-T, 5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5-MeO-MPMI)
|
---|
|
- Benzofurans (e.g., 5-MeO-DiBF, dimemebfe (5-MeO-BFE), mebfap)
- Benzothiophenes (e.g., 3-APBT)
- Indazoles (e.g., AL-38022A, O-methyl-AL-34662)
- Indenes (e.g., C-DMT)
- Isotryptamines (e.g., 6-MeO-isoDMT, Ro60-0175)
- MYCO-005
- Quinolinylethylamines (e.g., mefloquine)
|
---|
|
---|
| | |
---|
|
- Others: 2C-G-x (e.g., 2C-G-3, 2C-G-5)
- β-Keto-2C-B (βk-2C-B)
- β-Keto-2C-I (βk-2C-I)
- β-Methyl-2C-B (BMB)
- (e.g., BOB, BOD, BOH-2C-B)
- (e.g., HOT-2, HOT-7, HOT-17)
- N-Ethyl-2C-B
- (e.g., 2CD-2-ETO, 2CD-5-ETO, 2CE-5-ETO, 2CE-5iPrO, 2CT2-5-ETO, ASR-2001 (2CB-5PrO))
|
---|
| |
---|
| |
---|
| |
---|
| |
---|
| |
---|
| |
---|
Others |
- 2-TOET
- 2-TOM
- 25B-NAcPip
- 4-HA
- 5-TOET
- 5-TOM
- Benzofurans (e.g., 5-APB, 5-APDB, 6-APB, 6-APDB, F, F-2, F-22)
- Benzothiophenes (e.g., 5-APBT, 6-APBT)
- CT-5172
- DMAs (e.g., 2,4-DMA, 3,4-DMA)
- Fenfluramine
- MMA (3-MeO-4-MA)
- Norfenfluramine
- (e.g., 25D-NM-NDEAOP, DOB-NDEPA, DOI-NDEPA, DOM-NDEPA, DOTFM-NDEPA, M-NDEPA, TMA-2-NDEPA)
- PMA (4-MA)
- (e.g., TMA-3, TMA-4, TMA-5, TMA-6)
- TOMSO
- ZDCM-04
|
---|
|
- 1-Aminomethylindanes (e.g., 2CB-Ind, jimscaline)
- 2-Aminoindanes (e.g., DOM-AI)
- 3-Phenylpiperidines (e.g., LPH-5, LPH-48)
- Benzazepines (e.g., lorcaserin)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- DMBMPP (juncosamine)
- Ergolines/lysergamides (e.g., LSD)
- Glaucine
- IHCH-7113
- Partial ergolines (e.g., NDTDI, DEIMDHPCA, DEMPDHPCA, DEMTMPDHPCA, DEMNDHPCA)
- Phenylcyclopropylamines (e.g., DMCPA, TMT)
- Phenyloxazolamines (aminorexes) (e.g., 2C-B-aminorex)
- Z3517967757
- ZC-B
|
---|
|
---|
| |
---|
Others |
- Arylpiperazines (e.g., 2C-B-PP, 2-NP, mCPP, MK-212, ORG-12962, pCPP, pFPP, quipazine, TFMPP)
- Dihydrobenzoxazines (e.g., efavirenz)
- Phenoxyethylamines (e.g., CT-4719, ORG-37684)
- Quinazolinylethylamines (e.g., RH-34)
|
---|
Natural sources |
- Tryptamines: Acacia spp. (e.g., Acacia acuminata, Acacia confusa)
- Ayahuasca and vinho de Jurema (e.g., Psychotria viridis (chacruna), Dipolopterys cabrerana (chaliponga, chacruna), Mimosa tenuiflora (Mimosa hostilis; jurema))
- Brosimum (e.g., Brosimum acutifolium (takini))
- Hallucinogenic snuffs (e.g., Anadenanthera peregrina (yopo, jopo, cohoba, parica, ebene), Anadenanthera colubrina (vilca, cebil))
- Incilius alvarius (Bufo alvarius; Colorado River toad, Sonoran Desert toad; bufo)
- Psilocybin-containing mushrooms (magic mushrooms, shrooms) (e.g., Psilocybe cubensis, Psilocybe mexicana (teonanacatl))
- Lysergamides: Achnatherum robustum (sleepy grass)
- Epichloë spp.
- Ergot (Claviceps) (e.g., Claviceps purpurea, Claviceps paspali)
- Morning glory (Convolvulaceae) seeds (e.g., Ipomoea tricolor (tlitliltzin, badoh negro; Ipomoea violacea), Ipomoea corymbosa (coaxihuitl, ololiúqui; Rivea Corymbosa, Turbina Corymbosa), Argyreia nervosa (Hawaiian baby woodrose; HBWR))
- Periglandula spp. (e.g., Periglandula ipomoeae, Periglandula clandestina)
|
---|
|
|
---|
Tryptamines | |
---|
4-Hydroxytryptamines and esters/ethers | |
---|
5-Hydroxy- and 5-methoxytryptamines |
- 2-Methyl-5-HT
- 4-HO-5-MeO-T
- 4-F-5-MeO-DMT
- 4,5-DHP-DMT
- 4,5-DHT
- 4,5-MDO-DMT
- 4,5-MDO-DiPT
- 5-BT
- 5-Ethoxy-DMT
- 5-HO-DET
- 5-HO-DiPT
- 5-HO-NiPT
- 5-HO-DPT
- 5-HTP (oxitriptan)
- 5-MeO-2-TMT
- 5-MeO-34MPEMT
- 5-MeO-7,N,N-TMT
- 5-MeO-DALT
- 5-MeO-DBT
- 5-MeO-DET
- 5-MeO-DiPT
- 5-MeO-DMT (N,N,O-TMS; O-methylbufotenine)
- 5-MeO-DPT
- 5-MeO-EiPT
- 5-MeO-EPT
- 5-MeO-MALT
- 5-MeO-MET
- 5-MeO-MiPT
- 5-MeO-NET
- 5-MeO-NiPT
- 5-MeO-NMT (O,N-DMS)
- 5-MeO-PiPT
- 5-MeO-NBpBrT
- 5-MeO-T (5-MT; mexamine; O-methylserotonin)
- 5-MeO-T-NBOMe
- 5-MT-NB3OMe
- 5-NOT
- 5,6-DHT
- 5,6-MDO-DiPT
- 5,6-MDO-DMT
- 5,6-MDO-MiPT
- 5,6-MeO-MiPT
- 5,7-DHT
- Arachidonoyl serotonin
- ASR-3001 (5-MeO-iPALT)
- BAB
- Benanserin (BAS; SQ-4788)
- BGC20-761
- Bufotenidine (5-HTQ; N,N,N-TMS)
- Bufotenin (5-HO-DMT; N,N-DMS; mappine)
- Bufoviridine (5-SO-DMT)
- CP-132,484
- Cqd 280
- Cqd 285
- Cqdd 280
- Donitriptan
- EMDT (2-Et-5-MeO-DMT)
- HIOC
- Indorenate (TR-3369)
- Isamide (N-CA-5-MT)
- L-741604
- MS-245
- N-DEAOP-5-MeO-NET
- N-DEAOP-5-MeO-NMT
- N-Feruloylserotonin (moschamine)
- Norbufotenin (5-HO-NMT; NMS)
- O-Acetylbufotenine (5-AcO-DMT)
- O-Pivalylbufotenine (5-(t-BuCO)-DMT)
- Psilomethoxin (4-HO-5-MeO-DMT)
- Psilomethoxybin (4-PO-5-MeO-DMT)
- Serotonin (5-HT)
|
---|
N-Acetyltryptamines | |
---|
α-Alkyltryptamines |
- 5-Hydroxy- and 5-alkoxy-α-alkyltryptamines: 1-Pr-5-MeO-AMT
- 5-Allyloxy-AMT
- 5-Ethoxy-αMT
- 5-iPrO-αMT
- 5-MeO-αET
- 5-MeO-αMT (α,O-DMS; Alpha-O)
- α-Methyl-5-HTP
- α-Methylmelatonin
- α-Methylserotonin (5-HO-αMT; α-Me-5-HT)
- α,N,O-TMS (5-MeO-α,N-DMT)
- α,N,N,O-TeMS (5-MeO-α,N,N-TMT)
- AL-37350A (4,5-DHP-αMT)
- BW-723C86
|
---|
Cyclized tryptamines |
- Barettin
- Bufothionine
- Ciclindole
- Cyclic 3-OHM
- Ergolines and lysergamides (e.g., LSD)
- Flucindole
- Frovatriptan
- Harmala alkaloids and β-carbolines (e.g., 5-methoxyharmalan, 6-MeO-THH, 6-methoxyharmalan, 9-Me-BC, β-carboline (norharman), fenharmane, harmaline, harmalol, harmane, harmine, pinoline, tetrahydroharmine, tryptoline)
- Iboga alkaloids (e.g., ibogaine, ibogamine, noribogaine, tabernanthine)
- Ibogalogs (e.g., catharanthalog, fluorogainalog, ibogainalog, ibogaminalog (DM-506), LS-22925, noribogainalog, noribogaminalog, PNU-22394, tabernanthalog)
- Imidazolylindoles (e.g., AGH-107, AGH-192, AH-494)
- LY-266,097
- LY-344864
- Metralindole
- O-Methylnordehydrobufotenine
- Partial ergolines and lysergamides (e.g., NDTDI, RU-27849, RU-28251, RU-28306, FHATHBIN, LY-178210, Bay R 1531 (LY-197206), LY-293284, 10,11-seco-LSD, 10,11-secoergoline (α,N-Pip-T), CT-5252)
- Pertines (e.g., alpertine, milipertine, oxypertine, solypertine)
- PHA-57378
- Piperidinylethylindoles (e.g., Pip-T, indolylethylfentanyl)
- Pyrrolidinylethylindoles (e.g., Pyr-T, 4-HO-pyr-T, 5-MeO-pyr-T, 4-F-5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5F-MPMI, 5-MeO-MPMI, CP-135807, eletriptan)
- Tetrahydropyridinylindoles (e.g., RS134-49, RU-28253)
- Yohimbans (e.g., yohimbine, rauwolscine, spegatrine, corynanthine, ajmalicine, reserpine, deserpidine, rescinnamine)
|
---|
Isotryptamines | |
---|
Related compounds |
- 2-Azapsilocin
- 4-Aza-5-MeO-DPT
- 5-Aza-4-MeO-DiPT
- 5-HIAA
- 5-HIAL
- 5-HITCA
- 5-MIAL
- 7-Aza-5-MeO-DiPT
- Amedalin
- Benzindopyrine
- Benzofurans (e.g., 3-APB, 5-MeO-DiBF, BPAP, 3-F-BPAP, dimemebfe, mebfap)
- Benzothiophenes (e.g., 3-APBT)
- Carmoxirole
- CP-94253
- CT-4436
- Daledalin
- Gramine
- Histamine
- I-32
- IAL
- IN-399
- Indazoles (e.g., AL-34662, AL-38022A, O-methyl-AL-34662, VU6067416, YM-348)
- Indenes (e.g., C-DMT)
- Indolizines (e.g., TACT908 (2ZEDMA), 1ZP2MA, 1Z2MAP1O)
- Indolylaminopropanes (e.g., 1-API, 2-API, 4-API, 5-API (5-IT; PAL-571), 6-API (6-IT), 7-API)
- Iprindole
- Latrepirdine
- Masupirdine
- Medmain
- Molindone
- Non-tryptamine triptans (e.g., avitriptan, LY-334370, naratriptan)
- Phenethylamines (e.g., phenethylamine, amphetamine)
- Piperidinylindoles (e.g., BRL-54443, LY-334370, naratriptan, sertindole, SN-22)
- Pirlindole
- Pyridinylindoles (e.g., tepirindole)
- Pyrrolylethylamines (e.g., 2-pyrrolylethylamine (NEA), 3-pyrrolylethylamine (3-NEA), 3-pyrrolylpropylamine)
- Quinolinylethylamines (e.g., mefloquine)
- (R)-69 (3IQ)
- Ro60-0213
- Selisistat
- Tetrahydropyridinylindoles (e.g., EMD-386088, LY-367265, RU-24,969)
- Tetrindole
- Tiflucarbine
- Tipindole
- Zilpaterol (RU-42173)
|
---|
|