From Wikipedia, the free encyclopedia
Chemical compound
Pharmaceutical compound
1P-AL-LAD |
|
(6aR,9R)-N,N-diethyl-4-propanoyl-7-prop-2-enyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide
|
CAS Number | |
---|
PubChem CID | |
---|
|
Formula | C25H31N3O2 |
---|
Molar mass | 405.542 g·mol−1 |
---|
3D model (JSmol) | |
---|
CCC(=O)N1C=C2C[C@@H]3C(=C[C@H](CN3CC=C)C(=O)N(CC)CC)C4=C2C1=CC=C4
|
InChI=1S/C25H31N3O2/c1-5-12-27-15-18(25(30)26(7-3)8-4)13-20-19-10-9-11-21-24(19)17(14-22(20)27)16-28(21)23(29)6-2/h5,9-11,13,16,18,22H,1,6-8,12,14-15H2,2-4H3/t18-,22-/m1/s1 Key:GAGOTJNMWJYWMB-XMSQKQJNSA-N
|
1P-AL-LAD is a derivative of lysergic acid diethylamide (LSD) which has psychedelic effects and has been sold as a designer drug. It is believed to act as a prodrug for AL-LAD and produces a head-twitch response in animal studies.[1]
|
---|
| No ring subs. | |
---|
4-Hydroxytryptamines | |
---|
5-Hydroxytryptamines | |
---|
5-Methoxytryptamines | |
---|
Other ring subs. |
- 2,N,N-TMT
- 4,N,N-TMT
- 5-Bromo-DMT
- 5-Chloro-DMT
- 5-Fluoro-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 6-Fluoro-DMT
- Bretisilocin (GM-2505; 5-fluoro-MET)
|
---|
α-Alkyltryptamines |
- 5-Methoxy-α-alkyltryptamines: 5-MeO-AET
- α,N,N-TMT (α-Me-DMT; Alpha-N)
- 5-MeO-AMT (α,O-DMS; Alpha-O)
- α,N,O-TMS (5-MeO-α,N-DMT)
- α,N,N,O-TeMS (5-MeO-α,N,N-TMT)
|
---|
Others | |
---|
|
- Ergolines/lysergamides (e.g., LSD)
- β-Carbolines and Harmala alkaloids (e.g., harmine, harmaline, 6-methoxyharmalan)
- Iboga alkaloids (e.g., 18-MAC, 18-MC, coronaridine, ibogaine, ibogamine, ME-18-MC, noribogaine, tabernanthine, voacangine)
- Ibogalogs (e.g., ibogainalog)
- O-Methylnordehydrobufotenine
- Partial ergolines (e.g., NDTDI, RU-28306, CT-5252)
- Piperidinylethylindoles (e.g., Pip-T)
- Pyrrolidinylethylindoles (e.g., Pyr-T, 5-MeO-pyr-T)
- Pyrrolidinylmethylindoles (e.g., MPMI, 4-HO-MPMI (lucigenol), 5-MeO-MPMI)
|
---|
|
- Benzofurans (e.g., 5-MeO-DiBF, dimemebfe (5-MeO-BFE), mebfap)
- Benzothiophenes (e.g., 3-APBT)
- Indazoles (e.g., AL-38022A, O-methyl-AL-34662)
- Indenes (e.g., C-DMT)
- Isotryptamines (e.g., 6-MeO-isoDMT, Ro60-0175)
- MYCO-005
- Quinolinylethylamines (e.g., mefloquine)
|
---|
|
---|
| | |
---|
|
- Others: 2C-G-x (e.g., 2C-G-3, 2C-G-5)
- β-Keto-2C-B (βk-2C-B)
- β-Keto-2C-I (βk-2C-I)
- β-Methyl-2C-B (BMB)
- (e.g., BOB, BOD, BOH-2C-B)
- (e.g., HOT-2, HOT-7, HOT-17)
- N-Ethyl-2C-B
- (e.g., 2CD-2-ETO, 2CD-5-ETO, 2CE-5-ETO, 2CE-5iPrO, 2CT2-5-ETO, ASR-2001 (2CB-5PrO))
|
---|
| |
---|
| |
---|
| |
---|
| |
---|
| |
---|
| |
---|
| |
---|
Others |
- 2-TOET
- 2-TOM
- 25B-NAcPip
- 4-HA
- 5-TOET
- 5-TOM
- Benzofurans (e.g., 5-APB, 5-APDB, 6-APB, 6-APDB, F, F-2, F-22)
- Benzothiophenes (e.g., 5-APBT, 6-APBT)
- CT-5172
- DMAs (e.g., 2,4-DMA, 3,4-DMA)
- Fenfluramine
- MMA (3-MeO-4-MA)
- Norfenfluramine
- (e.g., 25D-NM-NDEAOP, DOB-NDEPA, DOI-NDEPA, DOM-NDEPA, DOTFM-NDEPA, M-NDEPA, TMA-2-NDEPA)
- PMA (4-MA)
- (e.g., TMA-3, TMA-4, TMA-5)
- TOMSO
- ZDCM-04
|
---|
|
- 1-Aminomethylindanes (e.g., 2CB-Ind, jimscaline)
- 2-Aminoindanes (e.g., DOM-AI)
- 3-Phenylpiperidines (e.g., LPH-5, LPH-48)
- Benzazepines (e.g., lorcaserin)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- DMBMPP (juncosamine)
- Ergolines/lysergamides (e.g., LSD)
- Glaucine
- IHCH-7113
- Partial ergolines (e.g., NDTDI, DEIMDHPCA, DEMPDHPCA, DEMTMPDHPCA, DEMNDHPCA)
- Phenylcyclopropylamines (e.g., DMCPA, TMT)
- Phenyloxazolamines (aminorexes) (e.g., 2C-B-aminorex)
- Z3517967757
- ZC-B
|
---|
|
---|
| |
---|
Others |
- Arylpiperazines (e.g., 2C-B-PP, 2-NP, mCPP, MK-212, ORG-12962, pCPP, pFPP, quipazine, TFMPP)
- Dihydrobenzoxazines (e.g., efavirenz)
- Phenoxyethylamines (e.g., CT-4719, ORG-37684)
- Quinazolinylethylamines (e.g., RH-34)
|
---|
Natural sources |
- Tryptamines: Acacia spp. (e.g., Acacia acuminata, Acacia confusa)
- Ayahuasca and vinho de Jurema (e.g., Psychotria viridis (chacruna), Dipolopterys cabrerana (chaliponga, chacruna), Mimosa tenuiflora (Mimosa hostilis; jurema))
- Brosimum (e.g., Brosimum acutifolium (takini))
- Hallucinogenic snuffs (e.g., Anadenanthera peregrina (yopo, jopo, cohoba, parica, ebene), Anadenanthera colubrina (vilca, cebil))
- Incilius alvarius (Bufo alvarius; Colorado River toad, Sonoran Desert toad; bufo)
- Psilocybin-containing mushrooms (magic mushrooms, shrooms) (e.g., Psilocybe cubensis, Psilocybe mexicana (teonanacatl))
- Lysergamides: Achnatherum robustum (sleepy grass)
- Epichloë spp.
- Ergot (Claviceps) (e.g., Claviceps purpurea, Claviceps paspali)
- Morning glory (Convolvulaceae) seeds (e.g., Ipomoea tricolor (tlitliltzin, badoh negro; Ipomoea violacea), Ipomoea corymbosa (coaxihuitl, ololiúqui; Rivea Corymbosa, Turbina Corymbosa), Argyreia nervosa (Hawaiian baby woodrose; HBWR))
- Periglandula spp. (e.g., Periglandula ipomoeae, Periglandula clandestina)
|
---|
|