From Wikipedia, the free encyclopedia
MDHOET
|
Names
|
Preferred IUPAC name
2-{[(2H-1,3-Benzodioxol-5-yl)propan-2-yl]amino}ethan-1-ol
|
Other names
3,4-Methylenedioxy-N-hydroxyethylamphetamine 3,4-Methylenedioxy-1-(alpha-methylaminohydroxyethyl)ethane MDOHET, MDHET, MDHEA
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
UNII
|
|
|
|
InChI=1S/C12H17NO3/c1-9(13-4-5-14)6-10-2-3-11-12(7-10)16-8-15-11/h2-3,7,9,13-14H,4-6,8H2,1H3 NKey: SCUUYKMQDUDNBP-UHFFFAOYSA-N N
|
C1=C2C(=CC=C1CC(C)NCCO)OCO2
|
Properties
|
|
C12H17NO3
|
Molar mass
|
223.271 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
MDHOET, or 3,4-methylenedioxy-N-hydroxyethylamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. It is also the N-hydroxyethyl analogue of MDA. MDHOET was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 50 mg. MDHOET produces few to no effects. Very little data exists about the pharmacology, pharmacokinetics, effects, and toxicity of MDHOET.
This substance is a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act.[1]
|
---|
Phenethylamines | |
---|
Amphetamines | |
---|
Phentermines | |
---|
Cathinones | |
---|
Phenylisobutylamines (and further-extended) | |
---|
Catecholamines (and close relatives) | |
---|
Cyclized phenethylamines | Phenylalkylpyrrolidines | |
---|
2-Benzylpiperidines (phenidates) | |
---|
Phenylmorpholines (phenmetrazines) | |
---|
Phenyloxazolamines (aminorexes) | |
---|
Isoquinolines and tetrahydroisoquinolines | |
---|
2-Aminoindanes | |
---|
2-Aminotetralins | |
---|
Others / unsorted |
- 1-Aminomethylindanes (e.g., 2CB-Ind, AMMI, bromojimscaline, jimscaline)
- 2-ADN
- 2-Benzhydrylpyrrolidine
- 2C-B-5-hemiFLY-α6 (BNAP)
- 3-Benzhydrylmorpholine
- 3-Phenylpiperidines (e.g., 3-phenylpiperidine, 3-PPP, OSU-6162 (PNU-96391), LPH-5, LPH-48, Z3517967757 (Z7757))
- 6-AB
- AL-1095
- Aminochromes (e.g., adrenochrome, adrenolutin)
- Benzazepines (e.g., fenoldopam, lorcaserin, SCHEMBL5334361)
- Benzocyclobutenes (e.g., 2CBCB-NBOMe, bromotomscaline, S33005, TCB-2, tomscaline)
- Benzoxepins (e.g., BBOX, IBOX, TFMBOX)
- Butyltolylquinuclidine
- Cypenamine (trans-2-phenylcyclopentylamine)
- Diphenidine
- Diphenylprolinol
- DMBMPP
- Ergolines (e.g., LSD)
- GYKI-52895
- HDMP-29
- Ivabradine
- Lumateperone and analogues (e.g., IHCH-7079, IHCH-7086, IHCH-7113, ITI-1549)
- Methoxphenidine
- Methylmorphenate
- Milnacipran
- MT-45
- 2-Naphthylamine
- Org 6582
- Partial ergolines (e.g., NDTDI, RU-27849, DEIMDHPCA, DEMPDHPCA, DEMPDHPCA-2C-D, RU-27251)
- PF-592,379
- Phenylcyclopropylamines (e.g., DMCPA, TMT, tranylcypromine)
- Tetrahydrobenzopyranylamines (e.g., CT-5126)
- Tricyclics (e.g., benzoctamine, dizocilpine)
- ZC-B
|
---|
|
---|
Related compounds |
- 2-Furylethylamine
- 2-Pyrrolylethylamine
- 3-Pyrrolylethylamine
- 3-Pyrrolylpropylamine
- 2-Tetrahydrofurylethylamine
- 4-Benzylpiperidine
- 7-AB
- Alkylamines (e.g., 1,3-DMBATooltip 1,3-dimethylbutylamine, 1,4-DMAATooltip 1,4-dimethylamylamine, heptaminol, iproheptine, isometheptene, methylhexanamine/1,3-DMAA, octodrine, oenethyl, tuaminoheptane)
- Benzylamines (e.g., benzylamine, α-methylbenzylamine, MDM1EA, ALPHA, M-ALPHA, pargyline)
- Benzylpiperazines (e.g., benzylpiperazine, MDBZP, fipexide)
- Cyclohexylaminopropanes (e.g., propylhexedrine, norpropylhexedrine)
- Cyclopentylaminopropanes (e.g., isocyclamine, cyclopentamine)
- Phenoxyethylamines (e.g., 3,4,5-trimethoxyphenoxyethylamine, CT-4719, ORG-37684)
- Phenylalkenylamines (e.g., phenylbutenamine)
- Phenylalkynylamines (e.g., phenylbutynamine)
- Phenylpiperazines (e.g., 1-phenylpiperazine, mCPPTooltip meta-chlorophenylpiperazine, TFMPPTooltip trifluoromethylphenylpiperazine, oMPPTooltip ortho-methylphenylpiperazine, pFPPTooltip para-fluorophenylpiperazine, pMeOPPTooltip para-methoxyphenylpiperazine)
- Phenylpropylamines (e.g., phenylpropylamine, homo-MDA, homo-MDMA)
- Thienylaminopropanes (thiopropamines) (e.g., thiopropamine, methiopropamine, thiothinone)
|
---|
|