From Wikipedia, the free encyclopedia
Anxiolytic drug
Pharmaceutical compound
ICI-190,622 |
|
ATC code | |
---|
|
4-Amino-1-pent-3-ynyl-N-prop-2-enylpyrazolo[3,4-b]pyridine-5-carboxamide
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C15H17N5O |
---|
Molar mass | 283.335 g·mol−1 |
---|
3D model (JSmol) | |
---|
CC#CCCN1C2=NC=C(C(=C2C=N1)N)C(=O)NCC=C
|
InChI=1S/C15H17N5O/c1-3-5-6-8-20-14-11(10-19-20)13(16)12(9-18-14)15(21)17-7-4-2/h4,9-10H,2,6-8H2,1H3,(H2,16,18)(H,17,21) NKey:ZPOHUNITDKKDQD-UHFFFAOYSA-N N
|
N Y (what is this?) (verify) |
ICI-190,622 is an anxiolytic drug used in scientific research. It is a pyrazolopyridine derivative, related to other anxiolytic compounds such as tracazolate, and more distantly to zaleplon. It has similar effects to benzodiazepine drugs, but is structurally distinct and so is classed as a nonbenzodiazepine anxiolytic.[1][2]
- ^
- ^ Bare TM, McLaren CD, Campbell JB, Firor JW, Resch JF, Walters CP, Salama AI, Meiners BA, Patel JB (December 1989). "Synthesis and structure-activity relationships of a series of anxioselective pyrazolopyridine ester and amide anxiolytic agents". Journal of Medicinal Chemistry. 32 (12): 2561–73. doi:10.1021/jm00132a011. PMID 2573731.
|
---|
5-HT1ARTooltip 5-HT1A receptor agonists | |
---|
GABAARTooltip GABAA receptor PAMsTooltip positive allosteric modulators | |
---|
Gabapentinoids (α2δ VDCC blockers) | |
---|
Antidepressants | |
---|
Sympatholytics (Antiadrenergics) |
- Alpha-1 blockers (e.g., prazosin)
- Alpha-2 agonists (e.g., clonidine, dexmedetomidine, guanfacine)
- Beta blockers (e.g., propranolol, atenolol, betaxolol, nadolol, oxprenolol, pindolol)
|
---|
Others | |
---|
|
|
---|
Alcohols | |
---|
Barbiturates | |
---|
Benzodiazepines | |
---|
Carbamates | |
---|
Flavonoids | |
---|
Imidazoles | |
---|
Kava constituents | |
---|
Monoureides | |
---|
Neuroactive steroids | |
---|
Nonbenzodiazepines | |
---|
Phenols | |
---|
Piperidinediones | |
---|
Pyrazolopyridines | |
---|
Quinazolinones | |
---|
Volatiles/gases | |
---|
Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Alogabat
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- Darigabat
- DEABL
- Deuterated etifoxine
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- KRM-II-81
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Nicotinic acid
- Nicotinamide
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
---|
|